C12H19NO3 — CID 11127978
ethyl (5E,7S)-1-methyl-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 11127978) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl (5E,7S)-1-methyl-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | ethyl (5E,7S)-1-methyl-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 11127978 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethyl (5E,7S)-1-methyl-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1/C=C/CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C12H19NO3/c1-3-16-12(15)10-7-5-4-6-8-13(2)11(14)9-10/h5,7,10H,3-4,6,8-9H2,1-2H3/b7-5+/t10-/m1/s1 |
| InChIKey | KKVOTVWHQNHZGS-BREXMAIKSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|