C9H12F3NO3 — CID 11128377
[(E)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 11128377) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | [(E)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 11128377 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [(E)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | C/C=C/COC(=O)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3/c1-3-4-5-16-7(14)6(2)13-8(15)9(10,11)12/h3-4,6H,5H2,1-2H3,(H,13,15)/b4-3+ |
| InChIKey | XOUBZDRTLVXXRR-ONEGZZNKSA-N |
| XLogP | 1.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|