C8H10F3NO3 — CID 86715158
[(Z)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 86715158) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | [(Z)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 86715158 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | [(Z)-but-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | C/C=C\COC(=O)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO3/c1-2-3-4-15-6(13)5-12-7(14)8(9,10)11/h2-3H,4-5H2,1H3,(H,12,14)/b3-2- |
| InChIKey | WYSVPROAMGJKBZ-IHWYPQMZSA-N |
| XLogP | 0.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|