C10H14F3NO3 — CID 139567609
[(E)-4,4,4-trifluorobut-2-enyl] 2-(diethylamino)-2-oxoacetate (PubChem CID 139567609) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is [(E)-4,4,4-trifluorobut-2-enyl] 2-(diethylamino)-2-oxoacetate.
| Compound Name | [(E)-4,4,4-trifluorobut-2-enyl] 2-(diethylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 139567609 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | [(E)-4,4,4-trifluorobut-2-enyl] 2-(diethylamino)-2-oxoacetate |
| SMILES | CCN(CC)C(=O)C(=O)OC/C=C/C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3/c1-3-14(4-2)8(15)9(16)17-7-5-6-10(11,12)13/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | DGWOHHMBGPPVPB-AATRIKPKSA-N |
| XLogP | 1.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|