C8H11F2NO3 — CID 139529726
[(Z)-but-2-enyl] 2-[(2,2-difluoroacetyl)amino]acetate (PubChem CID 139529726) has the molecular formula C8H11F2NO3 and a molecular weight of 207.18 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 2-[(2,2-difluoroacetyl)amino]acetate.
| Compound Name | [(Z)-but-2-enyl] 2-[(2,2-difluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 139529726 |
| Molecular Formula | C8H11F2NO3 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [(Z)-but-2-enyl] 2-[(2,2-difluoroacetyl)amino]acetate |
| SMILES | C/C=C\COC(=O)CNC(=O)C(F)F |
| InChI | InChI=1S/C8H11F2NO3/c1-2-3-4-14-6(12)5-11-8(13)7(9)10/h2-3,7H,4-5H2,1H3,(H,11,13)/b3-2- |
| InChIKey | LQRMJYOJIGLGRZ-IHWYPQMZSA-N |
| XLogP | 0.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|