C15H17NOS — CID 11129027
2,2,7-trimethyl-3,10-dihydro-1H-phenothiazin-4-one (PubChem CID 11129027) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2,2,7-trimethyl-3,10-dihydro-1H-phenothiazin-4-one.
| Compound Name | 2,2,7-trimethyl-3,10-dihydro-1H-phenothiazin-4-one |
|---|---|
| PubChem CID | 11129027 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,2,7-trimethyl-3,10-dihydro-1H-phenothiazin-4-one |
| SMILES | Cc1ccc2c(c1)SC1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C15H17NOS/c1-9-4-5-10-13(6-9)18-14-11(16-10)7-15(2,3)8-12(14)17/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | DYOHCCNNBUPPCC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|