C12H11NO3S — CID 86343850
7-methoxy-1,10-dihydropyrano[4,3-b][1,4]benzothiazin-4-one (PubChem CID 86343850) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 7-methoxy-1,10-dihydropyrano[4,3-b][1,4]benzothiazin-4-one.
| Compound Name | 7-methoxy-1,10-dihydropyrano[4,3-b][1,4]benzothiazin-4-one |
|---|---|
| PubChem CID | 86343850 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 7-methoxy-1,10-dihydropyrano[4,3-b][1,4]benzothiazin-4-one |
| SMILES | COc1ccc2c(c1)SC1=C(COCC1=O)N2 |
| InChI | InChI=1S/C12H11NO3S/c1-15-7-2-3-8-11(4-7)17-12-9(13-8)5-16-6-10(12)14/h2-4,13H,5-6H2,1H3 |
| InChIKey | YVDWYYXDYCOAPJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|