C18H14N2O6S — CID 71488741
[4-[(Z)-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl] 2-nitroacetate (PubChem CID 71488741) has the molecular formula C18H14N2O6S and a molecular weight of 386.39 g/mol. Its IUPAC name is [4-[(Z)-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl] 2-nitroacetate.
| Compound Name | [4-[(Z)-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl] 2-nitroacetate |
|---|---|
| PubChem CID | 71488741 |
| Molecular Formula | C18H14N2O6S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [4-[(Z)-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl] 2-nitroacetate |
| SMILES | COc1ccc2c(c1)S/C(=C\c1ccc(OC(=O)C[N+](=O)[O-])cc1)C(=O)N2 |
| InChI | InChI=1S/C18H14N2O6S/c1-25-13-6-7-14-15(9-13)27-16(18(22)19-14)8-11-2-4-12(5-3-11)26-17(21)10-20(23)24/h2-9H,10H2,1H3,(H,19,22)/b16-8- |
| InChIKey | GLBHAEMZOIPEEZ-PXNMLYILSA-N |
| XLogP | 2.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|