C24H20N2O8S2 — CID 71078441
7-[(2,6-dimethoxyphenyl)methylsulfonyl]-2-[(4-hydroxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 71078441) has the molecular formula C24H20N2O8S2 and a molecular weight of 528.56 g/mol. Its IUPAC name is 7-[(2,6-dimethoxyphenyl)methylsulfonyl]-2-[(4-hydroxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-[(2,6-dimethoxyphenyl)methylsulfonyl]-2-[(4-hydroxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71078441 |
| Molecular Formula | C24H20N2O8S2 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 7-[(2,6-dimethoxyphenyl)methylsulfonyl]-2-[(4-hydroxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cccc(OC)c1CS(=O)(=O)c1ccc2c(c1)SC(=Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)N2 |
| InChI | InChI=1S/C24H20N2O8S2/c1-33-20-4-3-5-21(34-2)16(20)13-36(31,32)15-7-8-17-22(12-15)35-23(24(28)25-17)11-14-6-9-19(27)18(10-14)26(29)30/h3-12,27H,13H2,1-2H3,(H,25,28) |
| InChIKey | STDDTDQPVURSAQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|