C24H16Cl2N2O7S2 — CID 89253135
[4-[(Z)-[7-[(2,6-dichlorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] acetate (PubChem CID 89253135) has the molecular formula C24H16Cl2N2O7S2 and a molecular weight of 579.44 g/mol. Its IUPAC name is [4-[(Z)-[7-[(2,6-dichlorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] acetate.
| Compound Name | [4-[(Z)-[7-[(2,6-dichlorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] acetate |
|---|---|
| PubChem CID | 89253135 |
| Molecular Formula | C24H16Cl2N2O7S2 |
| Molecular Weight | 579.44 g/mol |
| Exact Mass | 577.98 |
| IUPAC Name | [4-[(Z)-[7-[(2,6-dichlorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C2\Sc3cc(S(=O)(=O)Cc4c(Cl)cccc4Cl)ccc3NC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16Cl2N2O7S2/c1-13(29)35-21-8-5-14(9-20(21)28(31)32)10-23-24(30)27-19-7-6-15(11-22(19)36-23)37(33,34)12-16-17(25)3-2-4-18(16)26/h2-11H,12H2,1H3,(H,27,30)/b23-10- |
| InChIKey | QHUUCHILSUYYSW-RMORIDSASA-N |
| XLogP | 5.89 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|