C29H20F2N2O8S3 — CID 89253101
[4-[(Z)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] 4-methylbenzenesulfonate (PubChem CID 89253101) has the molecular formula C29H20F2N2O8S3 and a molecular weight of 658.68 g/mol. Its IUPAC name is [4-[(Z)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(Z)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89253101 |
| Molecular Formula | C29H20F2N2O8S3 |
| Molecular Weight | 658.68 g/mol |
| Exact Mass | 658.03 |
| IUPAC Name | [4-[(Z)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-2-nitrophenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\Sc4cc(S(=O)(=O)Cc5c(F)cccc5F)ccc4NC3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H20F2N2O8S3/c1-17-5-8-19(9-6-17)44(39,40)41-26-12-7-18(13-25(26)33(35)36)14-28-29(34)32-24-11-10-20(15-27(24)42-28)43(37,38)16-21-22(30)3-2-4-23(21)31/h2-15H,16H2,1H3,(H,32,34)/b28-14- |
| InChIKey | TWCORXGGDHXPSM-MUXKCCDJSA-N |
| XLogP | 6.01 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|