C24H20FNO3S2 — CID 71076631
(2E)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(4-fluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 71076631) has the molecular formula C24H20FNO3S2 and a molecular weight of 453.56 g/mol. Its IUPAC name is (2E)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(4-fluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(4-fluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71076631 |
| Molecular Formula | C24H20FNO3S2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (2E)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(4-fluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(C)c1CS(=O)(=O)c1ccc2c(c1)S/C(=C/c1ccc(F)cc1)C(=O)N2 |
| InChI | InChI=1S/C24H20FNO3S2/c1-15-4-3-5-16(2)20(15)14-31(28,29)19-10-11-21-22(13-19)30-23(24(27)26-21)12-17-6-8-18(25)9-7-17/h3-13H,14H2,1-2H3,(H,26,27)/b23-12+ |
| InChIKey | YWHPASBUGZEGKP-FSJBWODESA-N |
| XLogP | 5.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|