C22H13Br2F2NO3S2 — CID 71078279
(2Z)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4-difluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 71078279) has the molecular formula C22H13Br2F2NO3S2 and a molecular weight of 601.29 g/mol. Its IUPAC name is (2Z)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4-difluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4-difluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71078279 |
| Molecular Formula | C22H13Br2F2NO3S2 |
| Molecular Weight | 601.29 g/mol |
| Exact Mass | 598.87 |
| IUPAC Name | (2Z)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4-difluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Cc3c(Br)cccc3Br)cc2S/C1=C\c1ccc(F)cc1F |
| InChI | InChI=1S/C22H13Br2F2NO3S2/c23-16-2-1-3-17(24)15(16)11-32(29,30)14-6-7-19-20(10-14)31-21(22(28)27-19)8-12-4-5-13(25)9-18(12)26/h1-10H,11H2,(H,27,28)/b21-8- |
| InChIKey | GPJGZGKAGXQNOA-WNFQYIGGSA-N |
| XLogP | 6.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.29 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|