C22H16Br2N2O3S2 — CID 123529453
2-[(4-aminophenyl)methylidene]-7-[(2,6-dibromophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 123529453) has the molecular formula C22H16Br2N2O3S2 and a molecular weight of 580.32 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylidene]-7-[(2,6-dibromophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[(4-aminophenyl)methylidene]-7-[(2,6-dibromophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 123529453 |
| Molecular Formula | C22H16Br2N2O3S2 |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 577.90 |
| IUPAC Name | 2-[(4-aminophenyl)methylidene]-7-[(2,6-dibromophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | Nc1ccc(C=C2Sc3cc(S(=O)(=O)Cc4c(Br)cccc4Br)ccc3NC2=O)cc1 |
| InChI | InChI=1S/C22H16Br2N2O3S2/c23-17-2-1-3-18(24)16(17)12-31(28,29)15-8-9-19-20(11-15)30-21(22(27)26-19)10-13-4-6-14(25)7-5-13/h1-11H,12,25H2,(H,26,27) |
| InChIKey | HEHXPBWIBMMLEF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|