C29H31N3O3S2 — CID 71078014
(2Z)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 71078014) has the molecular formula C29H31N3O3S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is (2Z)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71078014 |
| Molecular Formula | C29H31N3O3S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (2Z)-7-[(2,6-dimethylphenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(C)c1CS(=O)(=O)c1ccc2c(c1)S/C(=C\c1ccc(N3CCN(C)CC3)cc1)C(=O)N2 |
| InChI | InChI=1S/C29H31N3O3S2/c1-20-5-4-6-21(2)25(20)19-37(34,35)24-11-12-26-27(18-24)36-28(29(33)30-26)17-22-7-9-23(10-8-22)32-15-13-31(3)14-16-32/h4-12,17-18H,13-16,19H2,1-3H3,(H,30,33)/b28-17- |
| InChIKey | QAEDMLMUUVGRBK-QRQIAZFYSA-N |
| XLogP | 5.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|