C31H26N2O6S2 — CID 90074549
(2Z)-6-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 90074549) has the molecular formula C31H26N2O6S2 and a molecular weight of 586.69 g/mol. Its IUPAC name is (2Z)-6-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-6-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074549 |
| Molecular Formula | C31H26N2O6S2 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | (2Z)-6-[(2,6-dimethylphenyl)methylsulfonyl]-2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(C)c1CS(=O)(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccc(OCc3ccccc3)c([N+](=O)[O-])c1)S2 |
| InChI | InChI=1S/C31H26N2O6S2/c1-20-7-6-8-21(2)25(20)19-41(37,38)24-12-14-29-26(17-24)32-31(34)30(40-29)16-23-11-13-28(27(15-23)33(35)36)39-18-22-9-4-3-5-10-22/h3-17H,18-19H2,1-2H3,(H,32,34)/b30-16- |
| InChIKey | CYIZGNAYDJALLZ-UHBFCERESA-N |
| XLogP | 6.85 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|