C23H17Br2NO3S2 — CID 90074922
(2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 90074922) has the molecular formula C23H17Br2NO3S2 and a molecular weight of 579.34 g/mol. Its IUPAC name is (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074922 |
| Molecular Formula | C23H17Br2NO3S2 |
| Molecular Weight | 579.34 g/mol |
| Exact Mass | 576.90 |
| IUPAC Name | (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(4-methylphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ccc(/C=C2/Sc3ccc(S(=O)(=O)Cc4c(Br)cccc4Br)cc3NC2=O)cc1 |
| InChI | InChI=1S/C23H17Br2NO3S2/c1-14-5-7-15(8-6-14)11-22-23(27)26-20-12-16(9-10-21(20)30-22)31(28,29)13-17-18(24)3-2-4-19(17)25/h2-12H,13H2,1H3,(H,26,27)/b22-11+ |
| InChIKey | BXSXCOYWLUIOAR-SSDVNMTOSA-N |
| XLogP | 6.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.34 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|