C24H19F2NO3S2 — CID 90074748
(2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethylphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 90074748) has the molecular formula C24H19F2NO3S2 and a molecular weight of 471.55 g/mol. Its IUPAC name is (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethylphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethylphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074748 |
| Molecular Formula | C24H19F2NO3S2 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethylphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(C)c1CS(=O)(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccc(F)cc1F)S2 |
| InChI | InChI=1S/C24H19F2NO3S2/c1-14-4-3-5-15(2)19(14)13-32(29,30)18-8-9-22-21(12-18)27-24(28)23(31-22)10-16-6-7-17(25)11-20(16)26/h3-12H,13H2,1-2H3,(H,27,28)/b23-10- |
| InChIKey | BZMLIUFGFVWVOV-RMORIDSASA-N |
| XLogP | 5.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|