C25H21F2NO6S2 — CID 90074545
(2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(2,4,6-trimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 90074545) has the molecular formula C25H21F2NO6S2 and a molecular weight of 533.57 g/mol. Its IUPAC name is (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(2,4,6-trimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(2,4,6-trimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074545 |
| Molecular Formula | C25H21F2NO6S2 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(2,4,6-trimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cc(OC)c(/C=C2/Sc3ccc(S(=O)(=O)Cc4c(F)cccc4F)cc3NC2=O)c(OC)c1 |
| InChI | InChI=1S/C25H21F2NO6S2/c1-32-14-9-21(33-2)16(22(10-14)34-3)12-24-25(29)28-20-11-15(7-8-23(20)35-24)36(30,31)13-17-18(26)5-4-6-19(17)27/h4-12H,13H2,1-3H3,(H,28,29)/b24-12+ |
| InChIKey | JMUMHAICFSUHBL-WYMPLXKRSA-N |
| XLogP | 5.05 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|