C24H19F2NO5S2 — CID 90074382
(2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethoxyphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 90074382) has the molecular formula C24H19F2NO5S2 and a molecular weight of 503.55 g/mol. Its IUPAC name is (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethoxyphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethoxyphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074382 |
| Molecular Formula | C24H19F2NO5S2 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | (2Z)-2-[(2,4-difluorophenyl)methylidene]-6-[(2,6-dimethoxyphenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cccc(OC)c1CS(=O)(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccc(F)cc1F)S2 |
| InChI | InChI=1S/C24H19F2NO5S2/c1-31-20-4-3-5-21(32-2)17(20)13-34(29,30)16-8-9-22-19(12-16)27-24(28)23(33-22)10-14-6-7-15(25)11-18(14)26/h3-12H,13H2,1-2H3,(H,27,28)/b23-10- |
| InChIKey | DBHXDNYHAFQNJQ-RMORIDSASA-N |
| XLogP | 5.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|