C24H16F2N2O7S2 — CID 71078340
methyl 4-[(E)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-3-nitrobenzoate (PubChem CID 71078340) has the molecular formula C24H16F2N2O7S2 and a molecular weight of 546.53 g/mol. Its IUPAC name is methyl 4-[(E)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-3-nitrobenzoate.
| Compound Name | methyl 4-[(E)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 71078340 |
| Molecular Formula | C24H16F2N2O7S2 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | methyl 4-[(E)-[7-[(2,6-difluorophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(/C=C2/Sc3cc(S(=O)(=O)Cc4c(F)cccc4F)ccc3NC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H16F2N2O7S2/c1-35-24(30)14-6-5-13(20(9-14)28(31)32)10-22-23(29)27-19-8-7-15(11-21(19)36-22)37(33,34)12-16-17(25)3-2-4-18(16)26/h2-11H,12H2,1H3,(H,27,29)/b22-10+ |
| InChIKey | VXDZUXIHQSGFBF-LSHDLFTRSA-N |
| XLogP | 4.72 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|