C23H16F2N2O6S2 — CID 90074725
(2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(4-methoxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 90074725) has the molecular formula C23H16F2N2O6S2 and a molecular weight of 518.52 g/mol. Its IUPAC name is (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(4-methoxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(4-methoxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90074725 |
| Molecular Formula | C23H16F2N2O6S2 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | (2E)-6-[(2,6-difluorophenyl)methylsulfonyl]-2-[(4-methoxy-3-nitrophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(/C=C2/Sc3ccc(S(=O)(=O)Cc4c(F)cccc4F)cc3NC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16F2N2O6S2/c1-33-20-7-5-13(9-19(20)27(29)30)10-22-23(28)26-18-11-14(6-8-21(18)34-22)35(31,32)12-15-16(24)3-2-4-17(15)25/h2-11H,12H2,1H3,(H,26,28)/b22-10+ |
| InChIKey | ADOZXOLHCCZLNZ-LSHDLFTRSA-N |
| XLogP | 4.94 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|