C22H12Br2F3NO3S2 — CID 90075067
(2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4,6-trifluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 90075067) has the molecular formula C22H12Br2F3NO3S2 and a molecular weight of 619.28 g/mol. Its IUPAC name is (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4,6-trifluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4,6-trifluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90075067 |
| Molecular Formula | C22H12Br2F3NO3S2 |
| Molecular Weight | 619.28 g/mol |
| Exact Mass | 616.86 |
| IUPAC Name | (2E)-6-[(2,6-dibromophenyl)methylsulfonyl]-2-[(2,4,6-trifluorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2cc(S(=O)(=O)Cc3c(Br)cccc3Br)ccc2S/C1=C/c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C22H12Br2F3NO3S2/c23-15-2-1-3-16(24)14(15)10-33(30,31)12-4-5-20-19(8-12)28-22(29)21(32-20)9-13-17(26)6-11(25)7-18(13)27/h1-9H,10H2,(H,28,29)/b21-9+ |
| InChIKey | AZDRAOIRAOZEHE-ZVBGSRNCSA-N |
| XLogP | 6.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|