C27H25Br2N3O3S2 — CID 71078198
(2E)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 71078198) has the molecular formula C27H25Br2N3O3S2 and a molecular weight of 663.46 g/mol. Its IUPAC name is (2E)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 71078198 |
| Molecular Formula | C27H25Br2N3O3S2 |
| Molecular Weight | 663.46 g/mol |
| Exact Mass | 660.97 |
| IUPAC Name | (2E)-7-[(2,6-dibromophenyl)methylsulfonyl]-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | CN1CCN(c2ccc(/C=C3/Sc4cc(S(=O)(=O)Cc5c(Br)cccc5Br)ccc4NC3=O)cc2)CC1 |
| InChI | InChI=1S/C27H25Br2N3O3S2/c1-31-11-13-32(14-12-31)19-7-5-18(6-8-19)15-26-27(33)30-24-10-9-20(16-25(24)36-26)37(34,35)17-21-22(28)3-2-4-23(21)29/h2-10,15-16H,11-14,17H2,1H3,(H,30,33)/b26-15+ |
| InChIKey | KKVLBSSXIZIFPT-CVKSISIWSA-N |
| XLogP | 6.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|