C25H20Br2N2O5S2 — CID 90075012
methyl 2-[4-[(E)-[6-[(2,6-dibromophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]anilino]acetate (PubChem CID 90075012) has the molecular formula C25H20Br2N2O5S2 and a molecular weight of 652.39 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[6-[(2,6-dibromophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]anilino]acetate.
| Compound Name | methyl 2-[4-[(E)-[6-[(2,6-dibromophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]anilino]acetate |
|---|---|
| PubChem CID | 90075012 |
| Molecular Formula | C25H20Br2N2O5S2 |
| Molecular Weight | 652.39 g/mol |
| Exact Mass | 649.92 |
| IUPAC Name | methyl 2-[4-[(E)-[6-[(2,6-dibromophenyl)methylsulfonyl]-3-oxo-4H-1,4-benzothiazin-2-ylidene]methyl]anilino]acetate |
| SMILES | COC(=O)CNc1ccc(/C=C2/Sc3ccc(S(=O)(=O)Cc4c(Br)cccc4Br)cc3NC2=O)cc1 |
| InChI | InChI=1S/C25H20Br2N2O5S2/c1-34-24(30)13-28-16-7-5-15(6-8-16)11-23-25(31)29-21-12-17(9-10-22(21)35-23)36(32,33)14-18-19(26)3-2-4-20(18)27/h2-12,28H,13-14H2,1H3,(H,29,31)/b23-11+ |
| InChIKey | KGIFCONSEQBSHQ-FOKLQQMPSA-N |
| XLogP | 5.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|