C17H11FN2O5S — CID 123717487
[4-[(6-fluoro-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-2-nitrophenyl] acetate (PubChem CID 123717487) has the molecular formula C17H11FN2O5S and a molecular weight of 374.35 g/mol. Its IUPAC name is [4-[(6-fluoro-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-2-nitrophenyl] acetate.
| Compound Name | [4-[(6-fluoro-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-2-nitrophenyl] acetate |
|---|---|
| PubChem CID | 123717487 |
| Molecular Formula | C17H11FN2O5S |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [4-[(6-fluoro-3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]-2-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C=C2Sc3ccc(F)cc3NC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11FN2O5S/c1-9(21)25-14-4-2-10(6-13(14)20(23)24)7-16-17(22)19-12-8-11(18)3-5-15(12)26-16/h2-8H,1H3,(H,19,22) |
| InChIKey | JDIMUUXYSILPPU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|