C16H20OS — CID 11129060
(2E)-3,7-dimethyl-5-phenylsulfanylocta-2,6-dienal (PubChem CID 11129060) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-5-phenylsulfanylocta-2,6-dienal.
| Compound Name | (2E)-3,7-dimethyl-5-phenylsulfanylocta-2,6-dienal |
|---|---|
| PubChem CID | 11129060 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2E)-3,7-dimethyl-5-phenylsulfanylocta-2,6-dienal |
| SMILES | CC(C)=CC(C/C(C)=C/C=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H20OS/c1-13(2)11-16(12-14(3)9-10-17)18-15-7-5-4-6-8-15/h4-11,16H,12H2,1-3H3/b14-9+ |
| InChIKey | GQLLASJYSLETJA-NTEUORMPSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|