C17H24BrIN4O — CID 111293360
1-[(4-bromophenyl)methyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111293360) has the molecular formula C17H24BrIN4O and a molecular weight of 507.21 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111293360 |
| Molecular Formula | C17H24BrIN4O |
| Molecular Weight | 507.21 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C17H23BrN4O.HI/c1-5-19-17(20-10-16-21-12(2)13(3)23-16)22(4)11-14-6-8-15(18)9-7-14;/h6-9H,5,10-11H2,1-4H3,(H,19,20);1H |
| InChIKey | YPLCUYVDHKPDQF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|