C20H26ClIN4OS — CID 111294860
1-[(2-chlorophenyl)methyl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111294860) has the molecular formula C20H26ClIN4OS and a molecular weight of 532.88 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111294860 |
| Molecular Formula | C20H26ClIN4OS |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)N(C)Cc1ccccc1Cl.I |
| InChI | InChI=1S/C20H25ClN4OS.HI/c1-3-22-20(24(2)13-15-6-4-5-7-17(15)21)23-12-19(26)25-10-8-18-16(14-25)9-11-27-18;/h4-7,9,11H,3,8,10,12-14H2,1-2H3,(H,22,23);1H |
| InChIKey | AFLJFSXRJKUGDU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|