C17H28N4OS — CID 111158625
1-butyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine (PubChem CID 111158625) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is 1-butyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine.
| Compound Name | 1-butyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111158625 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-butyl-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-ethyl-1-methylguanidine |
| SMILES | CCCCN(C)/C(=N/CC(=O)N1CCc2sccc2C1)NCC |
| InChI | InChI=1S/C17H28N4OS/c1-4-6-9-20(3)17(18-5-2)19-12-16(22)21-10-7-15-14(13-21)8-11-23-15/h8,11H,4-7,9-10,12-13H2,1-3H3,(H,18,19) |
| InChIKey | WXVKLTPCNNALBG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|