C18H28N4OS2 — CID 109487509
N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109487509) has the molecular formula C18H28N4OS2 and a molecular weight of 380.58 g/mol. Its IUPAC name is N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487509 |
| Molecular Formula | C18H28N4OS2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H28N4OS2/c1-4-19-17(22-8-10-25-18(2,3)13-22)20-11-16(23)21-7-5-15-14(12-21)6-9-24-15/h6,9H,4-5,7-8,10-13H2,1-3H3,(H,19,20) |
| InChIKey | FYEXYDMXMAQQBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|