C12H15FN2O5 — CID 11129875
3-ethoxy-4-fluoro-N-[(2S)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]benzamide (PubChem CID 11129875) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-ethoxy-4-fluoro-N-[(2S)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 3-ethoxy-4-fluoro-N-[(2S)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 11129875 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-ethoxy-4-fluoro-N-[(2S)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]benzamide |
| SMILES | CCOc1cc(C(=O)N[C@@H](CO)C(=O)NO)ccc1F |
| InChI | InChI=1S/C12H15FN2O5/c1-2-20-10-5-7(3-4-8(10)13)11(17)14-9(6-16)12(18)15-19/h3-5,9,16,19H,2,6H2,1H3,(H,14,17)(H,15,18)/t9-/m0/s1 |
| InChIKey | GPANAXSUDDHMPC-VIFPVBQESA-N |
| XLogP | -0.18 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|