C13H17NO2Se — CID 11130280
1-[(2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 11130280) has the molecular formula C13H17NO2Se and a molecular weight of 298.24 g/mol. Its IUPAC name is 1-[(2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11130280 |
| Molecular Formula | C13H17NO2Se |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-[(2S,3R)-3-hydroxy-2-(phenylselanylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H](O)[C@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C13H17NO2Se/c1-10(15)14-8-7-13(16)12(14)9-17-11-5-3-2-4-6-11/h2-6,12-13,16H,7-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | IHUUZXWXFDQKKS-CHWSQXEVSA-N |
| XLogP | 0.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|