C19H21FN6 — CID 111307644
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111307644) has the molecular formula C19H21FN6 and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111307644 |
| Molecular Formula | C19H21FN6 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1nncn1-c1ccccc1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN6/c1-21-19(25(2)13-15-8-10-16(20)11-9-15)22-12-18-24-23-14-26(18)17-6-4-3-5-7-17/h3-11,14H,12-13H2,1-2H3,(H,21,22) |
| InChIKey | PPRIIQZISIAUDJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|