C18H18F4N6 — CID 119132102
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine (PubChem CID 119132102) has the molecular formula C18H18F4N6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 119132102 |
| Molecular Formula | C18H18F4N6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1nnc2ccc(C(F)(F)F)cn12)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F4N6/c1-23-17(27(2)10-12-3-6-14(19)7-4-12)24-9-16-26-25-15-8-5-13(11-28(15)16)18(20,21)22/h3-8,11H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | ICBAONAPUNNFJF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|