C16H18F3IN6S — CID 119149550
2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 119149550) has the molecular formula C16H18F3IN6S and a molecular weight of 510.33 g/mol. Its IUPAC name is 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119149550 |
| Molecular Formula | C16H18F3IN6S |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1sccc1C)NCc1nnc2ccc(C(F)(F)F)cn12.I |
| InChI | InChI=1S/C16H17F3N6S.HI/c1-10-5-6-26-12(10)7-21-15(20-2)22-8-14-24-23-13-4-3-11(9-25(13)14)16(17,18)19;/h3-6,9H,7-8H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | XKBVISPDXGZLRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|