C15H15F3N6S — CID 119131214
2-methyl-1-(thiophen-2-ylmethyl)-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine (PubChem CID 119131214) has the molecular formula C15H15F3N6S and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-methyl-1-(thiophen-2-ylmethyl)-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-(thiophen-2-ylmethyl)-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 119131214 |
| Molecular Formula | C15H15F3N6S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-methyl-1-(thiophen-2-ylmethyl)-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccs1)NCc1nnc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C15H15F3N6S/c1-19-14(20-7-11-3-2-6-25-11)21-8-13-23-22-12-5-4-10(9-24(12)13)15(16,17)18/h2-6,9H,7-8H2,1H3,(H2,19,20,21) |
| InChIKey | WYSRSBHSAQUVCJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|