C19H22F3IN6 — CID 119131469
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 119131469) has the molecular formula C19H22F3IN6 and a molecular weight of 518.33 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119131469 |
| Molecular Formula | C19H22F3IN6 |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccc(C(F)(F)F)cn12)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C19H21F3N6.HI/c1-13-6-4-5-7-14(13)11-27(3)18(23-2)24-10-17-26-25-16-9-8-15(12-28(16)17)19(20,21)22;/h4-9,12H,10-11H2,1-3H3,(H,23,24);1H |
| InChIKey | DHDPEONBNADMMI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|