C15H23IN6S — CID 111298992
1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111298992) has the molecular formula C15H23IN6S and a molecular weight of 446.36 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111298992 |
| Molecular Formula | C15H23IN6S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1C)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C15H22N6S.HI/c1-16-15(17-9-14-19-18-11-21(14)3)20(2)10-12-5-7-13(22-4)8-6-12;/h5-8,11H,9-10H2,1-4H3,(H,16,17);1H |
| InChIKey | YAXDTRIEDYDVEF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|