C18H28O2Se — CID 11131997
(3S)-7-methoxy-3,7-dimethyl-2-methylidene-6-phenylselanyloctan-1-ol (PubChem CID 11131997) has the molecular formula C18H28O2Se and a molecular weight of 355.38 g/mol. Its IUPAC name is (3S)-7-methoxy-3,7-dimethyl-2-methylidene-6-phenylselanyloctan-1-ol.
| Compound Name | (3S)-7-methoxy-3,7-dimethyl-2-methylidene-6-phenylselanyloctan-1-ol |
|---|---|
| PubChem CID | 11131997 |
| Molecular Formula | C18H28O2Se |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (3S)-7-methoxy-3,7-dimethyl-2-methylidene-6-phenylselanyloctan-1-ol |
| SMILES | C=C(CO)[C@@H](C)CCC([Se]c1ccccc1)C(C)(C)OC |
| InChI | InChI=1S/C18H28O2Se/c1-14(15(2)13-19)11-12-17(18(3,4)20-5)21-16-9-7-6-8-10-16/h6-10,14,17,19H,2,11-13H2,1,3-5H3/t14-,17?/m0/s1 |
| InChIKey | MLASYKFQLUMXDQ-MBIQTGHCSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|