C13H22ClN5OSi2 — CID 11132025
N-(6-chloro-9-trimethylsilylpurin-2-yl)-N-trimethylsilylacetamide (PubChem CID 11132025) has the molecular formula C13H22ClN5OSi2 and a molecular weight of 355.98 g/mol. Its IUPAC name is N-(6-chloro-9-trimethylsilylpurin-2-yl)-N-trimethylsilylacetamide.
| Compound Name | N-(6-chloro-9-trimethylsilylpurin-2-yl)-N-trimethylsilylacetamide |
|---|---|
| PubChem CID | 11132025 |
| Molecular Formula | C13H22ClN5OSi2 |
| Molecular Weight | 355.98 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(6-chloro-9-trimethylsilylpurin-2-yl)-N-trimethylsilylacetamide |
| SMILES | CC(=O)N(c1nc(Cl)c2ncn([Si](C)(C)C)c2n1)[Si](C)(C)C |
| InChI | InChI=1S/C13H22ClN5OSi2/c1-9(20)19(22(5,6)7)13-16-11(14)10-12(17-13)18(8-15-10)21(2,3)4/h8H,1-7H3 |
| InChIKey | AKKSWSIFEGOBSP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.98 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|