About N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide
N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide (PubChem CID 137414010) has the molecular formula C13H7Cl2F3N6O3
and a molecular weight of 423.14 g/mol. Its IUPAC name is N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide.
Molecular Properties
| Compound Name | N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide |
| PubChem CID | 137414010 |
| Molecular Formula | C13H7Cl2F3N6O3 |
| Molecular Weight | 423.14 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1OC(F)(F)F |
| InChI | InChI=1S/C13H7Cl2F3N6O3/c1-5(25)24(26)6-2-3-7(20-11(6)27-13(16,17)18)23-4-19-8-9(14)21-12(15)22-10(8)23/h2-4,26H,1H3 |
| InChIKey | SZDJZSXRLHIVKP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide?
The IUPAC name of N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide (CID 137414010) is N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide.
What is the SMILES notation for N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide?
The canonical SMILES for N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide is CC(=O)N(O)c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1OC(F)(F)F.
What is the InChIKey of N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide?
The InChIKey is SZDJZSXRLHIVKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2F3N6O3/c1-5(25)24(26)6-2-3-7(20-11(6)27-13(16,17)18)23-4-19-8-9(14)21-12(15)22-10(8)23/h2-4,26H,1H3.
What are the key properties of N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide?
N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide has a molecular weight of 423.14 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,6-dichloropurin-9-yl)-2-(trifluoromethoxy)-3-pyridinyl]-N-hydroxyacetamide is sourced from PubChem (CID 137414010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).