C20H40O3Si2 — CID 11132795
tert-butyl-[[(1S,6R,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-oxabicyclo[4.2.1]non-3-en-7-yl]oxy]-dimethylsilane (PubChem CID 11132795) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is tert-butyl-[[(1S,6R,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-oxabicyclo[4.2.1]non-3-en-7-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,6R,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-oxabicyclo[4.2.1]non-3-en-7-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11132795 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl-[[(1S,6R,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-9-oxabicyclo[4.2.1]non-3-en-7-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC=CC[C@@H]1O2 |
| InChI | InChI=1S/C20H40O3Si2/c1-19(2,3)24(7,8)22-17-15-13-11-12-14-16(21-15)18(17)23-25(9,10)20(4,5)6/h11-12,15-18H,13-14H2,1-10H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | DNPUAGWGDNFGDN-XMTFNYHQSA-N |
| XLogP | 5.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|