C22H44O3Si2 — CID 11133412
tert-butyl-[[(1R,3Z,8S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-oxabicyclo[6.2.1]undec-3-en-9-yl]oxy]-dimethylsilane (PubChem CID 11133412) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is tert-butyl-[[(1R,3Z,8S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-oxabicyclo[6.2.1]undec-3-en-9-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3Z,8S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-oxabicyclo[6.2.1]undec-3-en-9-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11133412 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl-[[(1R,3Z,8S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-11-oxabicyclo[6.2.1]undec-3-en-9-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C/C=C\CCC[C@@H]1O2 |
| InChI | InChI=1S/C22H44O3Si2/c1-21(2,3)26(7,8)24-19-17-15-13-11-12-14-16-18(23-17)20(19)25-27(9,10)22(4,5)6/h11,13,17-20H,12,14-16H2,1-10H3/b13-11-/t17-,18+,19-,20-/m1/s1 |
| InChIKey | KYVBYAOSKBCNBG-RUBXQLJRSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|