C26H52O3Si — CID 11102257
tert-butyl-[(Z)-11-(2-hexyl-1,3-dioxolan-2-yl)undec-9-enoxy]-dimethylsilane (PubChem CID 11102257) has the molecular formula C26H52O3Si and a molecular weight of 440.79 g/mol. Its IUPAC name is tert-butyl-[(Z)-11-(2-hexyl-1,3-dioxolan-2-yl)undec-9-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-11-(2-hexyl-1,3-dioxolan-2-yl)undec-9-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11102257 |
| Molecular Formula | C26H52O3Si |
| Molecular Weight | 440.79 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | tert-butyl-[(Z)-11-(2-hexyl-1,3-dioxolan-2-yl)undec-9-enoxy]-dimethylsilane |
| SMILES | CCCCCCC1(C/C=C\CCCCCCCCO[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C26H52O3Si/c1-7-8-9-17-20-26(27-23-24-28-26)21-18-15-13-11-10-12-14-16-19-22-29-30(5,6)25(2,3)4/h15,18H,7-14,16-17,19-24H2,1-6H3/b18-15- |
| InChIKey | XVJQBEYTRGERBP-SDXDJHTJSA-N |
| XLogP | 8.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.79 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|