C20H40O3Si — CID 11660419
7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-4-yloxy-tri(propan-2-yl)silane (PubChem CID 11660419) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is 7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-4-yloxy-tri(propan-2-yl)silane.
| Compound Name | 7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-4-yloxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11660419 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-4-yloxy-tri(propan-2-yl)silane |
| SMILES | C=CCC(CCCC1(C)OCCO1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-9-11-19(12-10-13-20(8)21-14-15-22-20)23-24(16(2)3,17(4)5)18(6)7/h9,16-19H,1,10-15H2,2-8H3 |
| InChIKey | JEAQSJFRJDFNRJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|