C25H50O3Si2 — CID 11178541
triethyl-[(1R,2E)-5-methyl-1-[(2R,5R)-5-(2-triethylsilyloxyethyl)oxolan-2-yl]hexa-2,4-dienoxy]silane (PubChem CID 11178541) has the molecular formula C25H50O3Si2 and a molecular weight of 454.84 g/mol. Its IUPAC name is triethyl-[(1R,2E)-5-methyl-1-[(2R,5R)-5-(2-triethylsilyloxyethyl)oxolan-2-yl]hexa-2,4-dienoxy]silane.
| Compound Name | triethyl-[(1R,2E)-5-methyl-1-[(2R,5R)-5-(2-triethylsilyloxyethyl)oxolan-2-yl]hexa-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 11178541 |
| Molecular Formula | C25H50O3Si2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | triethyl-[(1R,2E)-5-methyl-1-[(2R,5R)-5-(2-triethylsilyloxyethyl)oxolan-2-yl]hexa-2,4-dienoxy]silane |
| SMILES | CC[Si](CC)(CC)OCC[C@H]1CC[C@H]([C@@H](/C=C/C=C(C)C)O[Si](CC)(CC)CC)O1 |
| InChI | InChI=1S/C25H50O3Si2/c1-9-29(10-2,11-3)26-21-20-23-18-19-24(27-23)25(17-15-16-22(7)8)28-30(12-4,13-5)14-6/h15-17,23-25H,9-14,18-21H2,1-8H3/b17-15+/t23-,24-,25-/m1/s1 |
| InChIKey | JUYWOJSTHHUZLO-XACHLHQKSA-N |
| XLogP | 7.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|