C31H60O4Si2 — CID 51051385
(1R,2E,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-yl]-5-methyl-7-methylideneundeca-2,4-dien-1-ol (PubChem CID 51051385) has the molecular formula C31H60O4Si2 and a molecular weight of 552.99 g/mol. Its IUPAC name is (1R,2E,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-yl]-5-methyl-7-methylideneundeca-2,4-dien-1-ol.
| Compound Name | (1R,2E,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-yl]-5-methyl-7-methylideneundeca-2,4-dien-1-ol |
|---|---|
| PubChem CID | 51051385 |
| Molecular Formula | C31H60O4Si2 |
| Molecular Weight | 552.99 g/mol |
| Exact Mass | 552.40 |
| IUPAC Name | (1R,2E,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxolan-2-yl]-5-methyl-7-methylideneundeca-2,4-dien-1-ol |
| SMILES | C=C(CCCC)[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C=C/[C@@H](O)[C@H]1CC[C@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H60O4Si2/c1-14-15-17-24(2)29(35-37(12,13)31(7,8)9)25(3)18-16-19-27(32)28-21-20-26(34-28)22-23-33-36(10,11)30(4,5)6/h16,18-19,26-29,32H,2,14-15,17,20-23H2,1,3-13H3/b19-16+,25-18+/t26-,27-,28-,29+/m1/s1 |
| InChIKey | HRTHHQCELQCTHR-SXIRIBHMSA-N |
| XLogP | 8.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.99 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|