C31H60O7Si — CID 10962851
(1S,4S)-1-[(2S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]oxolan-2-yl]-4-[(2S,5R,6S)-6-[(Z)-dec-1-enyl]-5-hydroxyoxan-2-yl]butane-1,4-diol (PubChem CID 10962851) has the molecular formula C31H60O7Si and a molecular weight of 572.90 g/mol. Its IUPAC name is (1S,4S)-1-[(2S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]oxolan-2-yl]-4-[(2S,5R,6S)-6-[(Z)-dec-1-enyl]-5-hydroxyoxan-2-yl]butane-1,4-diol.
| Compound Name | (1S,4S)-1-[(2S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]oxolan-2-yl]-4-[(2S,5R,6S)-6-[(Z)-dec-1-enyl]-5-hydroxyoxan-2-yl]butane-1,4-diol |
|---|---|
| PubChem CID | 10962851 |
| Molecular Formula | C31H60O7Si |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | (1S,4S)-1-[(2S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]oxolan-2-yl]-4-[(2S,5R,6S)-6-[(Z)-dec-1-enyl]-5-hydroxyoxan-2-yl]butane-1,4-diol |
| SMILES | CCCCCCCC/C=C\[C@@H]1O[C@H]([C@@H](O)CC[C@H](O)[C@@H]2CC[C@@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)O2)CC[C@H]1O |
| InChI | InChI=1S/C31H60O7Si/c1-7-8-9-10-11-12-13-14-15-27-25(34)18-19-28(37-27)23(32)16-17-24(33)29-20-21-30(38-29)26(35)22-36-39(5,6)31(2,3)4/h14-15,23-30,32-35H,7-13,16-22H2,1-6H3/b15-14-/t23-,24-,25+,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | DKSLOBYKCLUZPS-MJQSVXOISA-N |
| XLogP | 5.63 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|