About (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol
(1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol (PubChem CID 146682830) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol.
Molecular Properties
| Compound Name | (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol |
| PubChem CID | 146682830 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol |
| SMILES | CCC=CC=C(CO)[C@@H](O)[C@@H]1CC[C@H](CO)O1 |
| InChI | InChI=1S/C13H22O4/c1-2-3-4-5-10(8-14)13(16)12-7-6-11(9-15)17-12/h3-5,11-16H,2,6-9H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | KFBPVJSAIYMEDN-FRRDWIJNSA-N |
| XLogP | 0.77 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol?
The IUPAC name of (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol (CID 146682830) is (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol.
What is the SMILES notation for (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol?
The canonical SMILES for (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol is CCC=CC=C(CO)[C@@H](O)[C@@H]1CC[C@H](CO)O1.
What is the InChIKey of (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol?
The InChIKey is KFBPVJSAIYMEDN-FRRDWIJNSA-N. The full InChI is InChI=1S/C13H22O4/c1-2-3-4-5-10(8-14)13(16)12-7-6-11(9-15)17-12/h3-5,11-16H,2,6-9H2,1H3/t11-,12+,13-/m1/s1.
What are the key properties of (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol?
(1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol has a molecular weight of 242.31 g/mol, XLogP of 0.77, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(2S,5R)-5-(hydroxymethyl)oxolan-2-yl]-2-pent-2-enylidenepropane-1,3-diol is sourced from PubChem (CID 146682830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).